C17H16Cl2N2O5 — CID 1107945
N'-[2-(2,4-dichlorophenoxy)acetyl]-3,4-dimethoxybenzohydrazide (PubChem CID 1107945) has the molecular formula C17H16Cl2N2O5 and a molecular weight of 399.23 g/mol. Its IUPAC name is N'-[2-(2,4-dichlorophenoxy)acetyl]-3,4-dimethoxybenzohydrazide.
| Compound Name | N'-[2-(2,4-dichlorophenoxy)acetyl]-3,4-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 1107945 |
| Molecular Formula | C17H16Cl2N2O5 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | N'-[2-(2,4-dichlorophenoxy)acetyl]-3,4-dimethoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)COc2ccc(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C17H16Cl2N2O5/c1-24-14-5-3-10(7-15(14)25-2)17(23)21-20-16(22)9-26-13-6-4-11(18)8-12(13)19/h3-8H,9H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | PNVPUNTUFUYVRP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|