C18H18Cl2N2O4 — CID 1351524
2-(2,4-dichlorophenoxy)-N-[1-(3,4-dimethoxyphenyl)ethylideneamino]acetamide (PubChem CID 1351524) has the molecular formula C18H18Cl2N2O4 and a molecular weight of 397.26 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[1-(3,4-dimethoxyphenyl)ethylideneamino]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[1-(3,4-dimethoxyphenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 1351524 |
| Molecular Formula | C18H18Cl2N2O4 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[1-(3,4-dimethoxyphenyl)ethylideneamino]acetamide |
| SMILES | COc1ccc(C(C)=NNC(=O)COc2ccc(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C18H18Cl2N2O4/c1-11(12-4-6-16(24-2)17(8-12)25-3)21-22-18(23)10-26-15-7-5-13(19)9-14(15)20/h4-9H,10H2,1-3H3,(H,22,23) |
| InChIKey | GNGMMXWLRUIOEW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|