C16H12Cl4N2O2 — CID 19685551
N-[(E)-1-(4-chlorophenyl)ethylideneamino]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 19685551) has the molecular formula C16H12Cl4N2O2 and a molecular weight of 406.10 g/mol. Its IUPAC name is N-[(E)-1-(4-chlorophenyl)ethylideneamino]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[(E)-1-(4-chlorophenyl)ethylideneamino]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 19685551 |
| Molecular Formula | C16H12Cl4N2O2 |
| Molecular Weight | 406.10 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | N-[(E)-1-(4-chlorophenyl)ethylideneamino]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | C/C(=N\NC(=O)COc1cc(Cl)c(Cl)cc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12Cl4N2O2/c1-9(10-2-4-11(17)5-3-10)21-22-16(23)8-24-15-7-13(19)12(18)6-14(15)20/h2-7H,8H2,1H3,(H,22,23)/b21-9+ |
| InChIKey | KBWDGYBWYLBAHD-ZVBGSRNCSA-N |
| XLogP | 5.22 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.10 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|