C20H15Cl3N2O2 — CID 4583055
N-(1-naphthalen-2-ylethylideneamino)-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 4583055) has the molecular formula C20H15Cl3N2O2 and a molecular weight of 421.71 g/mol. Its IUPAC name is N-(1-naphthalen-2-ylethylideneamino)-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-(1-naphthalen-2-ylethylideneamino)-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 4583055 |
| Molecular Formula | C20H15Cl3N2O2 |
| Molecular Weight | 421.71 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | N-(1-naphthalen-2-ylethylideneamino)-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | CC(=NNC(=O)COc1cc(Cl)c(Cl)cc1Cl)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H15Cl3N2O2/c1-12(14-7-6-13-4-2-3-5-15(13)8-14)24-25-20(26)11-27-19-10-17(22)16(21)9-18(19)23/h2-10H,11H2,1H3,(H,25,26) |
| InChIKey | TYCVXQKKQHEYMG-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.71 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|