C11H11Cl3N2O2 — CID 4604451
N-(propan-2-ylideneamino)-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 4604451) has the molecular formula C11H11Cl3N2O2 and a molecular weight of 309.58 g/mol. Its IUPAC name is N-(propan-2-ylideneamino)-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-(propan-2-ylideneamino)-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 4604451 |
| Molecular Formula | C11H11Cl3N2O2 |
| Molecular Weight | 309.58 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | N-(propan-2-ylideneamino)-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | CC(C)=NNC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl3N2O2/c1-6(2)15-16-11(17)5-18-10-4-8(13)7(12)3-9(10)14/h3-4H,5H2,1-2H3,(H,16,17) |
| InChIKey | LGIRLNFLNPGFCI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|