C12H13Cl3N2O3 — CID 2454817
N-(2-acetamidoethyl)-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 2454817) has the molecular formula C12H13Cl3N2O3 and a molecular weight of 339.61 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-(2-acetamidoethyl)-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 2454817 |
| Molecular Formula | C12H13Cl3N2O3 |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | N-(2-acetamidoethyl)-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | CC(=O)NCCNC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H13Cl3N2O3/c1-7(18)16-2-3-17-12(19)6-20-11-5-9(14)8(13)4-10(11)15/h4-5H,2-3,6H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | IXBUEHFJDGKPIY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|