C14H18Cl3NO3 — CID 103772604
N-(4-hydroxy-2,2-dimethylbutyl)-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 103772604) has the molecular formula C14H18Cl3NO3 and a molecular weight of 354.66 g/mol. Its IUPAC name is N-(4-hydroxy-2,2-dimethylbutyl)-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-(4-hydroxy-2,2-dimethylbutyl)-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 103772604 |
| Molecular Formula | C14H18Cl3NO3 |
| Molecular Weight | 354.66 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | N-(4-hydroxy-2,2-dimethylbutyl)-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | CC(C)(CCO)CNC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H18Cl3NO3/c1-14(2,3-4-19)8-18-13(20)7-21-12-6-10(16)9(15)5-11(12)17/h5-6,19H,3-4,7-8H2,1-2H3,(H,18,20) |
| InChIKey | AKKWLOCDIFCPAD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.66 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|