C13H18Cl4N2O2 — CID 120653226
N-[(2R)-2-(ethylamino)propyl]-2-(2,4,5-trichlorophenoxy)acetamide;hydrochloride (PubChem CID 120653226) has the molecular formula C13H18Cl4N2O2 and a molecular weight of 376.11 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-2-(2,4,5-trichlorophenoxy)acetamide;hydrochloride.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-2-(2,4,5-trichlorophenoxy)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120653226 |
| Molecular Formula | C13H18Cl4N2O2 |
| Molecular Weight | 376.11 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-2-(2,4,5-trichlorophenoxy)acetamide;hydrochloride |
| SMILES | CCN[C@H](C)CNC(=O)COc1cc(Cl)c(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C13H17Cl3N2O2.ClH/c1-3-17-8(2)6-18-13(19)7-20-12-5-10(15)9(14)4-11(12)16;/h4-5,8,17H,3,6-7H2,1-2H3,(H,18,19);1H/t8-;/m1./s1 |
| InChIKey | CDUWWVUJRZAEJO-DDWIOCJRSA-N |
| XLogP | 3.56 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.11 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|