C11H10Cl3NO4 — CID 54991090
(2R)-2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]propanoic acid (PubChem CID 54991090) has the molecular formula C11H10Cl3NO4 and a molecular weight of 326.56 g/mol. Its IUPAC name is (2R)-2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 54991090 |
| Molecular Formula | C11H10Cl3NO4 |
| Molecular Weight | 326.56 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | (2R)-2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]propanoic acid |
| SMILES | C[C@@H](NC(=O)COc1cc(Cl)c(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C11H10Cl3NO4/c1-5(11(17)18)15-10(16)4-19-9-3-7(13)6(12)2-8(9)14/h2-3,5H,4H2,1H3,(H,15,16)(H,17,18)/t5-/m1/s1 |
| InChIKey | BEDUIRRILKGNDG-RXMQYKEDSA-N |
| XLogP | 2.61 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|