C11H11Cl2NO4 — CID 43170839
2-[[2-(3,4-dichlorophenoxy)acetyl]amino]propanoic acid (PubChem CID 43170839) has the molecular formula C11H11Cl2NO4 and a molecular weight of 292.12 g/mol. Its IUPAC name is 2-[[2-(3,4-dichlorophenoxy)acetyl]amino]propanoic acid.
| Compound Name | 2-[[2-(3,4-dichlorophenoxy)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43170839 |
| Molecular Formula | C11H11Cl2NO4 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 2-[[2-(3,4-dichlorophenoxy)acetyl]amino]propanoic acid |
| SMILES | CC(NC(=O)COc1ccc(Cl)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C11H11Cl2NO4/c1-6(11(16)17)14-10(15)5-18-7-2-3-8(12)9(13)4-7/h2-4,6H,5H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | HHYQKFJDYPJRJF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |