C14H17Cl2NO4 — CID 43423967
methyl 2-[[2-(3,4-dichlorophenoxy)acetyl]amino]-3-methylbutanoate (PubChem CID 43423967) has the molecular formula C14H17Cl2NO4 and a molecular weight of 334.20 g/mol. Its IUPAC name is methyl 2-[[2-(3,4-dichlorophenoxy)acetyl]amino]-3-methylbutanoate.
| Compound Name | methyl 2-[[2-(3,4-dichlorophenoxy)acetyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 43423967 |
| Molecular Formula | C14H17Cl2NO4 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | methyl 2-[[2-(3,4-dichlorophenoxy)acetyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)COc1ccc(Cl)c(Cl)c1)C(C)C |
| InChI | InChI=1S/C14H17Cl2NO4/c1-8(2)13(14(19)20-3)17-12(18)7-21-9-4-5-10(15)11(16)6-9/h4-6,8,13H,7H2,1-3H3,(H,17,18) |
| InChIKey | XJNRECPUZCUFOY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |