C11H13Cl2NO4 — CID 79676223
2-(3,4-dichlorophenoxy)-N-(2-methoxyethoxy)acetamide (PubChem CID 79676223) has the molecular formula C11H13Cl2NO4 and a molecular weight of 294.13 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)-N-(2-methoxyethoxy)acetamide.
| Compound Name | 2-(3,4-dichlorophenoxy)-N-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 79676223 |
| Molecular Formula | C11H13Cl2NO4 |
| Molecular Weight | 294.13 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)-N-(2-methoxyethoxy)acetamide |
| SMILES | COCCONC(=O)COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2NO4/c1-16-4-5-18-14-11(15)7-17-8-2-3-9(12)10(13)6-8/h2-3,6H,4-5,7H2,1H3,(H,14,15) |
| InChIKey | URKSKOSNQAZIKS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.13 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|