C11H10Cl3NO2 — CID 115636790
N-(2-chloroprop-2-enyl)-2-(3,4-dichlorophenoxy)acetamide (PubChem CID 115636790) has the molecular formula C11H10Cl3NO2 and a molecular weight of 294.57 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-2-(3,4-dichlorophenoxy)acetamide.
| Compound Name | N-(2-chloroprop-2-enyl)-2-(3,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 115636790 |
| Molecular Formula | C11H10Cl3NO2 |
| Molecular Weight | 294.57 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-2-(3,4-dichlorophenoxy)acetamide |
| SMILES | C=C(Cl)CNC(=O)COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H10Cl3NO2/c1-7(12)5-15-11(16)6-17-8-2-3-9(13)10(14)4-8/h2-4H,1,5-6H2,(H,15,16) |
| InChIKey | FMZQSVKOQJOLQA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.57 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |