C10H10Cl2N2O4S — CID 154687843
2-(3,4-dichlorophenoxy)-N'-ethenylsulfonylacetohydrazide (PubChem CID 154687843) has the molecular formula C10H10Cl2N2O4S and a molecular weight of 325.17 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)-N'-ethenylsulfonylacetohydrazide.
| Compound Name | 2-(3,4-dichlorophenoxy)-N'-ethenylsulfonylacetohydrazide |
|---|---|
| PubChem CID | 154687843 |
| Molecular Formula | C10H10Cl2N2O4S |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)-N'-ethenylsulfonylacetohydrazide |
| SMILES | C=CS(=O)(=O)NNC(=O)COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H10Cl2N2O4S/c1-2-19(16,17)14-13-10(15)6-18-7-3-4-8(11)9(12)5-7/h2-5,14H,1,6H2,(H,13,15) |
| InChIKey | FECPNHZZKYUHNG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|