C10H9ClFNO2 — CID 155716981
2-(4-chloro-3-fluorophenoxy)-N-ethenylacetamide (PubChem CID 155716981) has the molecular formula C10H9ClFNO2 and a molecular weight of 229.64 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenoxy)-N-ethenylacetamide.
| Compound Name | 2-(4-chloro-3-fluorophenoxy)-N-ethenylacetamide |
|---|---|
| PubChem CID | 155716981 |
| Molecular Formula | C10H9ClFNO2 |
| Molecular Weight | 229.64 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 2-(4-chloro-3-fluorophenoxy)-N-ethenylacetamide |
| SMILES | C=CNC(=O)COc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C10H9ClFNO2/c1-2-13-10(14)6-15-7-3-4-8(11)9(12)5-7/h2-5H,1,6H2,(H,13,14) |
| InChIKey | MRFFNWFAOMRIBO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.64 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |