C21H18Cl3FN2O3 — CID 138632707
(E)-N-[4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]but-1-en-2-yl]-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 138632707) has the molecular formula C21H18Cl3FN2O3 and a molecular weight of 471.74 g/mol. Its IUPAC name is (E)-N-[4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]but-1-en-2-yl]-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]but-1-en-2-yl]-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 138632707 |
| Molecular Formula | C21H18Cl3FN2O3 |
| Molecular Weight | 471.74 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | (E)-N-[4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]but-1-en-2-yl]-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | C=C(CCNC(=O)COc1ccc(Cl)c(F)c1)NC(=O)/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H18Cl3FN2O3/c1-13(27-20(28)7-3-14-2-5-16(22)18(24)10-14)8-9-26-21(29)12-30-15-4-6-17(23)19(25)11-15/h2-7,10-11H,1,8-9,12H2,(H,26,29)(H,27,28)/b7-3+ |
| InChIKey | JBYPVLMAKDWZCL-XVNBXDOJSA-N |
| XLogP | 5.01 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.74 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|