C21H18ClF4N3O4 — CID 138632706
(E)-N-[3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]but-3-enyl]-3-[5-(trifluoromethoxy)-2-pyridinyl]prop-2-enamide (PubChem CID 138632706) has the molecular formula C21H18ClF4N3O4 and a molecular weight of 487.84 g/mol. Its IUPAC name is (E)-N-[3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]but-3-enyl]-3-[5-(trifluoromethoxy)-2-pyridinyl]prop-2-enamide.
| Compound Name | (E)-N-[3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]but-3-enyl]-3-[5-(trifluoromethoxy)-2-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 138632706 |
| Molecular Formula | C21H18ClF4N3O4 |
| Molecular Weight | 487.84 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | (E)-N-[3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]but-3-enyl]-3-[5-(trifluoromethoxy)-2-pyridinyl]prop-2-enamide |
| SMILES | C=C(CCNC(=O)/C=C/c1ccc(OC(F)(F)F)cn1)NC(=O)COc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C21H18ClF4N3O4/c1-13(29-20(31)12-32-15-5-6-17(22)18(23)10-15)8-9-27-19(30)7-3-14-2-4-16(11-28-14)33-21(24,25)26/h2-7,10-11H,1,8-9,12H2,(H,27,30)(H,29,31)/b7-3+ |
| InChIKey | ZZXFTBVNICGHKR-XVNBXDOJSA-N |
| XLogP | 4.00 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.84 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|