C21H23Cl2FN2O4 — CID 167012937
4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-N-[(3Z,5Z)-6-chloro-5-methoxy-2-methylidenehexa-3,5-dienyl]pent-4-enamide (PubChem CID 167012937) has the molecular formula C21H23Cl2FN2O4 and a molecular weight of 457.33 g/mol. Its IUPAC name is 4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-N-[(3Z,5Z)-6-chloro-5-methoxy-2-methylidenehexa-3,5-dienyl]pent-4-enamide.
| Compound Name | 4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-N-[(3Z,5Z)-6-chloro-5-methoxy-2-methylidenehexa-3,5-dienyl]pent-4-enamide |
|---|---|
| PubChem CID | 167012937 |
| Molecular Formula | C21H23Cl2FN2O4 |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-N-[(3Z,5Z)-6-chloro-5-methoxy-2-methylidenehexa-3,5-dienyl]pent-4-enamide |
| SMILES | C=C(/C=C\C(=C\Cl)OC)CNC(=O)CCC(=C)NC(=O)COc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C21H23Cl2FN2O4/c1-14(4-6-17(11-22)29-3)12-25-20(27)9-5-15(2)26-21(28)13-30-16-7-8-18(23)19(24)10-16/h4,6-8,10-11H,1-2,5,9,12-13H2,3H3,(H,25,27)(H,26,28)/b6-4-,17-11- |
| InChIKey | HXTUDLZPPGEAAG-FGAITNTMSA-N |
| XLogP | 4.22 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|