C11H11Cl2N3O2 — CID 154687601
N-[2-(cyanoamino)ethyl]-2-(3,4-dichlorophenoxy)acetamide (PubChem CID 154687601) has the molecular formula C11H11Cl2N3O2 and a molecular weight of 288.13 g/mol. Its IUPAC name is N-[2-(cyanoamino)ethyl]-2-(3,4-dichlorophenoxy)acetamide.
| Compound Name | N-[2-(cyanoamino)ethyl]-2-(3,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 154687601 |
| Molecular Formula | C11H11Cl2N3O2 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | N-[2-(cyanoamino)ethyl]-2-(3,4-dichlorophenoxy)acetamide |
| SMILES | N#CNCCNC(=O)COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2N3O2/c12-9-2-1-8(5-10(9)13)18-6-11(17)16-4-3-15-7-14/h1-2,5,15H,3-4,6H2,(H,16,17) |
| InChIKey | KYORFLCMKCICAP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|