C26H34Cl2N2O4 — CID 17233325
2-(4-chloro-3-methylphenoxy)-N-[8-[[2-(4-chloro-3-methylphenoxy)acetyl]amino]octyl]acetamide (PubChem CID 17233325) has the molecular formula C26H34Cl2N2O4 and a molecular weight of 509.47 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-[8-[[2-(4-chloro-3-methylphenoxy)acetyl]amino]octyl]acetamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-[8-[[2-(4-chloro-3-methylphenoxy)acetyl]amino]octyl]acetamide |
|---|---|
| PubChem CID | 17233325 |
| Molecular Formula | C26H34Cl2N2O4 |
| Molecular Weight | 509.47 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-[8-[[2-(4-chloro-3-methylphenoxy)acetyl]amino]octyl]acetamide |
| SMILES | Cc1cc(OCC(=O)NCCCCCCCCNC(=O)COc2ccc(Cl)c(C)c2)ccc1Cl |
| InChI | InChI=1S/C26H34Cl2N2O4/c1-19-15-21(9-11-23(19)27)33-17-25(31)29-13-7-5-3-4-6-8-14-30-26(32)18-34-22-10-12-24(28)20(2)16-22/h9-12,15-16H,3-8,13-14,17-18H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | CCDWSXAWPRZVFK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.47 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|