C18H18ClNO5 — CID 55747351
N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-(4-chloro-3-methylphenoxy)acetamide (PubChem CID 55747351) has the molecular formula C18H18ClNO5 and a molecular weight of 363.80 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-(4-chloro-3-methylphenoxy)acetamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-(4-chloro-3-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 55747351 |
| Molecular Formula | C18H18ClNO5 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-(4-chloro-3-methylphenoxy)acetamide |
| SMILES | Cc1cc(OCC(=O)NCCOc2ccc3c(c2)OCO3)ccc1Cl |
| InChI | InChI=1S/C18H18ClNO5/c1-12-8-13(2-4-15(12)19)23-10-18(21)20-6-7-22-14-3-5-16-17(9-14)25-11-24-16/h2-5,8-9H,6-7,10-11H2,1H3,(H,20,21) |
| InChIKey | ODXDVIYPNCULDK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|