C20H24N4O5 — CID 90492281
2-(1,3-benzodioxol-5-yloxy)-N-[2-(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)oxyethyl]acetamide (PubChem CID 90492281) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-N-[2-(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)oxyethyl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-N-[2-(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)oxyethyl]acetamide |
|---|---|
| PubChem CID | 90492281 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-N-[2-(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)oxyethyl]acetamide |
| SMILES | Cc1nc(OCCNC(=O)COc2ccc3c(c2)OCO3)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C20H24N4O5/c1-14-22-18(24-7-2-3-8-24)11-20(23-14)26-9-6-21-19(25)12-27-15-4-5-16-17(10-15)29-13-28-16/h4-5,10-11H,2-3,6-9,12-13H2,1H3,(H,21,25) |
| InChIKey | VLYUWALMHROGFS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|