C21H28N4O4 — CID 90491866
2,4-dimethoxy-N-[2-(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)oxyethyl]benzamide (PubChem CID 90491866) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[2-(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)oxyethyl]benzamide.
| Compound Name | 2,4-dimethoxy-N-[2-(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)oxyethyl]benzamide |
|---|---|
| PubChem CID | 90491866 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 2,4-dimethoxy-N-[2-(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)oxyethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCOc2cc(N3CCCCC3)nc(C)n2)c(OC)c1 |
| InChI | InChI=1S/C21H28N4O4/c1-15-23-19(25-10-5-4-6-11-25)14-20(24-15)29-12-9-22-21(26)17-8-7-16(27-2)13-18(17)28-3/h7-8,13-14H,4-6,9-12H2,1-3H3,(H,22,26) |
| InChIKey | LBBATOKKIGDGMV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|