C21H27N5O6 — CID 90491868
4,5-dimethoxy-N-[2-(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)oxyethyl]-2-nitrobenzamide (PubChem CID 90491868) has the molecular formula C21H27N5O6 and a molecular weight of 445.48 g/mol. Its IUPAC name is 4,5-dimethoxy-N-[2-(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)oxyethyl]-2-nitrobenzamide.
| Compound Name | 4,5-dimethoxy-N-[2-(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)oxyethyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 90491868 |
| Molecular Formula | C21H27N5O6 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 4,5-dimethoxy-N-[2-(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)oxyethyl]-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)NCCOc2cc(N3CCCCC3)nc(C)n2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H27N5O6/c1-14-23-19(25-8-5-4-6-9-25)13-20(24-14)32-10-7-22-21(27)15-11-17(30-2)18(31-3)12-16(15)26(28)29/h11-13H,4-10H2,1-3H3,(H,22,27) |
| InChIKey | BMQHCMPCLSEMIH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 128.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|