C18H20N6O7 — CID 90491741
N-[2-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)oxyethyl]-3,5-dinitrobenzamide (PubChem CID 90491741) has the molecular formula C18H20N6O7 and a molecular weight of 432.39 g/mol. Its IUPAC name is N-[2-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)oxyethyl]-3,5-dinitrobenzamide.
| Compound Name | N-[2-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)oxyethyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 90491741 |
| Molecular Formula | C18H20N6O7 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-[2-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)oxyethyl]-3,5-dinitrobenzamide |
| SMILES | Cc1nc(OCCNC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H20N6O7/c1-12-20-16(22-3-6-30-7-4-22)11-17(21-12)31-5-2-19-18(25)13-8-14(23(26)27)10-15(9-13)24(28)29/h8-11H,2-7H2,1H3,(H,19,25) |
| InChIKey | UTMQGKBLKSHYAQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 162.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|