C21H23FN6O3 — CID 90491814
3-(4-fluorophenyl)-N-[2-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)oxyethyl]-1H-pyrazole-5-carboxamide (PubChem CID 90491814) has the molecular formula C21H23FN6O3 and a molecular weight of 426.45 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[2-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)oxyethyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N-[2-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)oxyethyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90491814 |
| Molecular Formula | C21H23FN6O3 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[2-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)oxyethyl]-1H-pyrazole-5-carboxamide |
| SMILES | Cc1nc(OCCNC(=O)c2cc(-c3ccc(F)cc3)n[nH]2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C21H23FN6O3/c1-14-24-19(28-7-10-30-11-8-28)13-20(25-14)31-9-6-23-21(29)18-12-17(26-27-18)15-2-4-16(22)5-3-15/h2-5,12-13H,6-11H2,1H3,(H,23,29)(H,26,27) |
| InChIKey | OMKAZUFFQJQIJD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|