C19H23FN4O4 — CID 90491762
2-(2-fluorophenoxy)-N-[2-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)oxyethyl]acetamide (PubChem CID 90491762) has the molecular formula C19H23FN4O4 and a molecular weight of 390.42 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N-[2-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)oxyethyl]acetamide.
| Compound Name | 2-(2-fluorophenoxy)-N-[2-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)oxyethyl]acetamide |
|---|---|
| PubChem CID | 90491762 |
| Molecular Formula | C19H23FN4O4 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-(2-fluorophenoxy)-N-[2-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)oxyethyl]acetamide |
| SMILES | Cc1nc(OCCNC(=O)COc2ccccc2F)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H23FN4O4/c1-14-22-17(24-7-10-26-11-8-24)12-19(23-14)27-9-6-21-18(25)13-28-16-5-3-2-4-15(16)20/h2-5,12H,6-11,13H2,1H3,(H,21,25) |
| InChIKey | FKRSGLWWTXLDSR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|