C18H17FN6O2 — CID 90544240
3-(4-fluorophenyl)-N-(6-morpholin-4-ylpyrimidin-4-yl)-1H-pyrazole-5-carboxamide (PubChem CID 90544240) has the molecular formula C18H17FN6O2 and a molecular weight of 368.37 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(6-morpholin-4-ylpyrimidin-4-yl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N-(6-morpholin-4-ylpyrimidin-4-yl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90544240 |
| Molecular Formula | C18H17FN6O2 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(6-morpholin-4-ylpyrimidin-4-yl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1cc(N2CCOCC2)ncn1)c1cc(-c2ccc(F)cc2)n[nH]1 |
| InChI | InChI=1S/C18H17FN6O2/c19-13-3-1-12(2-4-13)14-9-15(24-23-14)18(26)22-16-10-17(21-11-20-16)25-5-7-27-8-6-25/h1-4,9-11H,5-8H2,(H,23,24)(H,20,21,22,26) |
| InChIKey | QROXPSYHAOATDT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |