C17H20F2N6O2 — CID 122327886
1-(2,5-difluorophenyl)-3-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]urea (PubChem CID 122327886) has the molecular formula C17H20F2N6O2 and a molecular weight of 378.38 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]urea.
| Compound Name | 1-(2,5-difluorophenyl)-3-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 122327886 |
| Molecular Formula | C17H20F2N6O2 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]urea |
| SMILES | O=C(NCCNc1cc(N2CCOCC2)ncn1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C17H20F2N6O2/c18-12-1-2-13(19)14(9-12)24-17(26)21-4-3-20-15-10-16(23-11-22-15)25-5-7-27-8-6-25/h1-2,9-11H,3-8H2,(H,20,22,23)(H2,21,24,26) |
| InChIKey | UKSVLJJYYIDGBS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|