C18H20ClF3N6O2 — CID 122327846
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]urea (PubChem CID 122327846) has the molecular formula C18H20ClF3N6O2 and a molecular weight of 444.85 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 122327846 |
| Molecular Formula | C18H20ClF3N6O2 |
| Molecular Weight | 444.85 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]urea |
| SMILES | O=C(NCCNc1cc(N2CCOCC2)ncn1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H20ClF3N6O2/c19-14-2-1-12(9-13(14)18(20,21)22)27-17(29)24-4-3-23-15-10-16(26-11-25-15)28-5-7-30-8-6-28/h1-2,9-11H,3-8H2,(H,23,25,26)(H2,24,27,29) |
| InChIKey | KQPVAPHDEFIMEI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.85 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|