C20H22F6N6O2 — CID 122294072
1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]urea (PubChem CID 122294072) has the molecular formula C20H22F6N6O2 and a molecular weight of 492.42 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 122294072 |
| Molecular Formula | C20H22F6N6O2 |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]urea |
| SMILES | Cc1nc(NCCNC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H22F6N6O2/c1-12-29-16(11-17(30-12)32-4-6-34-7-5-32)27-2-3-28-18(33)31-15-9-13(19(21,22)23)8-14(10-15)20(24,25)26/h8-11H,2-7H2,1H3,(H,27,29,30)(H2,28,31,33) |
| InChIKey | GNYLEERFLRPVLG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|