C19H22ClF3N6O — CID 121074995
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]urea (PubChem CID 121074995) has the molecular formula C19H22ClF3N6O and a molecular weight of 442.87 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 121074995 |
| Molecular Formula | C19H22ClF3N6O |
| Molecular Weight | 442.87 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]urea |
| SMILES | Cc1nc(NCCNC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C19H22ClF3N6O/c1-12-26-16(11-17(27-12)29-8-2-3-9-29)24-6-7-25-18(30)28-13-4-5-15(20)14(10-13)19(21,22)23/h4-5,10-11H,2-3,6-9H2,1H3,(H,24,26,27)(H2,25,28,30) |
| InChIKey | MDWHUXDQZVWTJN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.87 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|