C18H19ClF3N5O — CID 91966682
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(4-piperidin-1-ylpyrimidin-2-yl)methyl]urea (PubChem CID 91966682) has the molecular formula C18H19ClF3N5O and a molecular weight of 413.83 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(4-piperidin-1-ylpyrimidin-2-yl)methyl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(4-piperidin-1-ylpyrimidin-2-yl)methyl]urea |
|---|---|
| PubChem CID | 91966682 |
| Molecular Formula | C18H19ClF3N5O |
| Molecular Weight | 413.83 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(4-piperidin-1-ylpyrimidin-2-yl)methyl]urea |
| SMILES | O=C(NCc1nccc(N2CCCCC2)n1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H19ClF3N5O/c19-14-5-4-12(10-13(14)18(20,21)22)25-17(28)24-11-15-23-7-6-16(26-15)27-8-2-1-3-9-27/h4-7,10H,1-3,8-9,11H2,(H2,24,25,28) |
| InChIKey | IVRULSXRVBDGDQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.83 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |