C18H21N5O3 — CID 91966664
1-(1,3-benzodioxol-5-yl)-3-[(4-piperidin-1-ylpyrimidin-2-yl)methyl]urea (PubChem CID 91966664) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[(4-piperidin-1-ylpyrimidin-2-yl)methyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[(4-piperidin-1-ylpyrimidin-2-yl)methyl]urea |
|---|---|
| PubChem CID | 91966664 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[(4-piperidin-1-ylpyrimidin-2-yl)methyl]urea |
| SMILES | O=C(NCc1nccc(N2CCCCC2)n1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H21N5O3/c24-18(21-13-4-5-14-15(10-13)26-12-25-14)20-11-16-19-7-6-17(22-16)23-8-2-1-3-9-23/h4-7,10H,1-3,8-9,11-12H2,(H2,20,21,24) |
| InChIKey | PIGZXLPRBLZYSS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |