C19H24N6O3 — CID 121074987
1-(1,3-benzodioxol-5-yl)-3-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]urea (PubChem CID 121074987) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 121074987 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]urea |
| SMILES | Cc1nc(NCCNC(=O)Nc2ccc3c(c2)OCO3)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C19H24N6O3/c1-13-22-17(11-18(23-13)25-8-2-3-9-25)20-6-7-21-19(26)24-14-4-5-15-16(10-14)28-12-27-15/h4-5,10-11H,2-3,6-9,12H2,1H3,(H,20,22,23)(H2,21,24,26) |
| InChIKey | DLNOQCZXNCERMB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|