C19H24N6O4 — CID 121075692
1-(1,3-benzodioxol-5-yl)-3-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]urea (PubChem CID 121075692) has the molecular formula C19H24N6O4 and a molecular weight of 400.44 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 121075692 |
| Molecular Formula | C19H24N6O4 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]urea |
| SMILES | Cc1cc(N2CCOCC2)nc(NCCNC(=O)Nc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C19H24N6O4/c1-13-10-17(25-6-8-27-9-7-25)24-18(22-13)20-4-5-21-19(26)23-14-2-3-15-16(11-14)29-12-28-15/h2-3,10-11H,4-9,12H2,1H3,(H,20,22,24)(H2,21,23,26) |
| InChIKey | PDNKNVCATXAKJN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 109.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|