C19H25ClN6O2 — CID 121075689
1-(3-chloro-4-methylphenyl)-3-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]urea (PubChem CID 121075689) has the molecular formula C19H25ClN6O2 and a molecular weight of 404.90 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 121075689 |
| Molecular Formula | C19H25ClN6O2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]urea |
| SMILES | Cc1cc(N2CCOCC2)nc(NCCNC(=O)Nc2ccc(C)c(Cl)c2)n1 |
| InChI | InChI=1S/C19H25ClN6O2/c1-13-3-4-15(12-16(13)20)24-19(27)22-6-5-21-18-23-14(2)11-17(25-18)26-7-9-28-10-8-26/h3-4,11-12H,5-10H2,1-2H3,(H,21,23,25)(H2,22,24,27) |
| InChIKey | SOUFWTFSGKXIOZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|