C19H23ClFN5O2 — CID 122295266
2-(2-chloro-6-fluorophenyl)-N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]acetamide (PubChem CID 122295266) has the molecular formula C19H23ClFN5O2 and a molecular weight of 407.88 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 122295266 |
| Molecular Formula | C19H23ClFN5O2 |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]acetamide |
| SMILES | Cc1cc(N2CCOCC2)nc(NCCNC(=O)Cc2c(F)cccc2Cl)n1 |
| InChI | InChI=1S/C19H23ClFN5O2/c1-13-11-17(26-7-9-28-10-8-26)25-19(24-13)23-6-5-22-18(27)12-14-15(20)3-2-4-16(14)21/h2-4,11H,5-10,12H2,1H3,(H,22,27)(H,23,24,25) |
| InChIKey | SALWNURPMWKATC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|