C19H22F3N5O3 — CID 122295200
N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]-3-(trifluoromethoxy)benzamide (PubChem CID 122295200) has the molecular formula C19H22F3N5O3 and a molecular weight of 425.41 g/mol. Its IUPAC name is N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]-3-(trifluoromethoxy)benzamide.
| Compound Name | N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]-3-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 122295200 |
| Molecular Formula | C19H22F3N5O3 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]-3-(trifluoromethoxy)benzamide |
| SMILES | Cc1cc(N2CCOCC2)nc(NCCNC(=O)c2cccc(OC(F)(F)F)c2)n1 |
| InChI | InChI=1S/C19H22F3N5O3/c1-13-11-16(27-7-9-29-10-8-27)26-18(25-13)24-6-5-23-17(28)14-3-2-4-15(12-14)30-19(20,21)22/h2-4,11-12H,5-10H2,1H3,(H,23,28)(H,24,25,26) |
| InChIKey | DYGCRFXSIUMHDJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|