C25H28FN5O2 — CID 122294494
3-(4-fluorophenoxy)-N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]benzamide (PubChem CID 122294494) has the molecular formula C25H28FN5O2 and a molecular weight of 449.53 g/mol. Its IUPAC name is 3-(4-fluorophenoxy)-N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]benzamide.
| Compound Name | 3-(4-fluorophenoxy)-N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 122294494 |
| Molecular Formula | C25H28FN5O2 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 3-(4-fluorophenoxy)-N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]benzamide |
| SMILES | Cc1cc(N2CCCCC2)nc(NCCNC(=O)c2cccc(Oc3ccc(F)cc3)c2)n1 |
| InChI | InChI=1S/C25H28FN5O2/c1-18-16-23(31-14-3-2-4-15-31)30-25(29-18)28-13-12-27-24(32)19-6-5-7-22(17-19)33-21-10-8-20(26)9-11-21/h5-11,16-17H,2-4,12-15H2,1H3,(H,27,32)(H,28,29,30) |
| InChIKey | JBRJRZXMPZGZAN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|