C19H24F2N6O — CID 122294332
1-(2,6-difluorophenyl)-3-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]urea (PubChem CID 122294332) has the molecular formula C19H24F2N6O and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]urea.
| Compound Name | 1-(2,6-difluorophenyl)-3-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 122294332 |
| Molecular Formula | C19H24F2N6O |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]urea |
| SMILES | Cc1cc(N2CCCCC2)nc(NCCNC(=O)Nc2c(F)cccc2F)n1 |
| InChI | InChI=1S/C19H24F2N6O/c1-13-12-16(27-10-3-2-4-11-27)25-18(24-13)22-8-9-23-19(28)26-17-14(20)6-5-7-15(17)21/h5-7,12H,2-4,8-11H2,1H3,(H,22,24,25)(H2,23,26,28) |
| InChIKey | GSWGMAQMYNMABT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|