C16H22N6OS — CID 122295083
1-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]-3-thiophen-2-ylurea (PubChem CID 122295083) has the molecular formula C16H22N6OS and a molecular weight of 346.46 g/mol. Its IUPAC name is 1-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]-3-thiophen-2-ylurea.
| Compound Name | 1-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]-3-thiophen-2-ylurea |
|---|---|
| PubChem CID | 122295083 |
| Molecular Formula | C16H22N6OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]-3-thiophen-2-ylurea |
| SMILES | Cc1cc(N2CCCC2)nc(NCCNC(=O)Nc2cccs2)n1 |
| InChI | InChI=1S/C16H22N6OS/c1-12-11-13(22-8-2-3-9-22)20-15(19-12)17-6-7-18-16(23)21-14-5-4-10-24-14/h4-5,10-11H,2-3,6-9H2,1H3,(H,17,19,20)(H2,18,21,23) |
| InChIKey | RMXXVHHMQHTPTN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|