C18H22F2N6O — CID 122294845
1-(2,6-difluorophenyl)-3-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]urea (PubChem CID 122294845) has the molecular formula C18H22F2N6O and a molecular weight of 376.41 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]urea.
| Compound Name | 1-(2,6-difluorophenyl)-3-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 122294845 |
| Molecular Formula | C18H22F2N6O |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]urea |
| SMILES | Cc1cc(N2CCCC2)nc(NCCNC(=O)Nc2c(F)cccc2F)n1 |
| InChI | InChI=1S/C18H22F2N6O/c1-12-11-15(26-9-2-3-10-26)24-17(23-12)21-7-8-22-18(27)25-16-13(19)5-4-6-14(16)20/h4-6,11H,2-3,7-10H2,1H3,(H,21,23,24)(H2,22,25,27) |
| InChIKey | QICUXTRIIUUYKI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|