C21H28FN5O2 — CID 122294488
2-(2-fluorophenoxy)-N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]propanamide (PubChem CID 122294488) has the molecular formula C21H28FN5O2 and a molecular weight of 401.49 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]propanamide.
| Compound Name | 2-(2-fluorophenoxy)-N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 122294488 |
| Molecular Formula | C21H28FN5O2 |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 2-(2-fluorophenoxy)-N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]propanamide |
| SMILES | Cc1cc(N2CCCCC2)nc(NCCNC(=O)C(C)Oc2ccccc2F)n1 |
| InChI | InChI=1S/C21H28FN5O2/c1-15-14-19(27-12-6-3-7-13-27)26-21(25-15)24-11-10-23-20(28)16(2)29-18-9-5-4-8-17(18)22/h4-5,8-9,14,16H,3,6-7,10-13H2,1-2H3,(H,23,28)(H,24,25,26) |
| InChIKey | BSFBQTDEJCMPFP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|