C18H21F2N5O — CID 121075195
2,4-difluoro-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]benzamide (PubChem CID 121075195) has the molecular formula C18H21F2N5O and a molecular weight of 361.40 g/mol. Its IUPAC name is 2,4-difluoro-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]benzamide.
| Compound Name | 2,4-difluoro-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 121075195 |
| Molecular Formula | C18H21F2N5O |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2,4-difluoro-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]benzamide |
| SMILES | Cc1cc(N2CCCC2)nc(NCCNC(=O)c2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C18H21F2N5O/c1-12-10-16(25-8-2-3-9-25)24-18(23-12)22-7-6-21-17(26)14-5-4-13(19)11-15(14)20/h4-5,10-11H,2-3,6-9H2,1H3,(H,21,26)(H,22,23,24) |
| InChIKey | NUBXZSNCFOZDKS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|