C19H23Cl2N5O — CID 70703179
2,4-dichloro-N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]benzamide (PubChem CID 70703179) has the molecular formula C19H23Cl2N5O and a molecular weight of 408.33 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 70703179 |
| Molecular Formula | C19H23Cl2N5O |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 2,4-dichloro-N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]benzamide |
| SMILES | Cc1cc(N2CCCCC2)nc(NCCNC(=O)c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C19H23Cl2N5O/c1-13-11-17(26-9-3-2-4-10-26)25-19(24-13)23-8-7-22-18(27)15-6-5-14(20)12-16(15)21/h5-6,11-12H,2-4,7-10H2,1H3,(H,22,27)(H,23,24,25) |
| InChIKey | VGZPDIGLWYPTLU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|