C16H22N6O2 — CID 122294344
N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]-1,2-oxazole-5-carboxamide (PubChem CID 122294344) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 122294344 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(N2CCCCC2)nc(NCCNC(=O)c2ccno2)n1 |
| InChI | InChI=1S/C16H22N6O2/c1-12-11-14(22-9-3-2-4-10-22)21-16(20-12)18-8-7-17-15(23)13-5-6-19-24-13/h5-6,11H,2-4,7-10H2,1H3,(H,17,23)(H,18,20,21) |
| InChIKey | QZJXDIPZEHVMIZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|