C20H24F3N5O — CID 122294987
N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 122294987) has the molecular formula C20H24F3N5O and a molecular weight of 407.44 g/mol. Its IUPAC name is N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 122294987 |
| Molecular Formula | C20H24F3N5O |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1cc(N2CCCC2)nc(NCCNC(=O)Cc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C20H24F3N5O/c1-14-12-17(28-10-2-3-11-28)27-19(26-14)25-9-8-24-18(29)13-15-4-6-16(7-5-15)20(21,22)23/h4-7,12H,2-3,8-11,13H2,1H3,(H,24,29)(H,25,26,27) |
| InChIKey | QLASEYBUAIZHSY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|