C19H22F3N5O2 — CID 122294939
N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]-2-(trifluoromethoxy)benzamide (PubChem CID 122294939) has the molecular formula C19H22F3N5O2 and a molecular weight of 409.41 g/mol. Its IUPAC name is N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]-2-(trifluoromethoxy)benzamide.
| Compound Name | N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]-2-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 122294939 |
| Molecular Formula | C19H22F3N5O2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]-2-(trifluoromethoxy)benzamide |
| SMILES | Cc1cc(N2CCCC2)nc(NCCNC(=O)c2ccccc2OC(F)(F)F)n1 |
| InChI | InChI=1S/C19H22F3N5O2/c1-13-12-16(27-10-4-5-11-27)26-18(25-13)24-9-8-23-17(28)14-6-2-3-7-15(14)29-19(20,21)22/h2-3,6-7,12H,4-5,8-11H2,1H3,(H,23,28)(H,24,25,26) |
| InChIKey | DMNHRHYKLLXMJK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|