C18H22FN5O — CID 121075153
3-fluoro-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]benzamide (PubChem CID 121075153) has the molecular formula C18H22FN5O and a molecular weight of 343.41 g/mol. Its IUPAC name is 3-fluoro-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]benzamide.
| Compound Name | 3-fluoro-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 121075153 |
| Molecular Formula | C18H22FN5O |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 3-fluoro-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]benzamide |
| SMILES | Cc1cc(N2CCCC2)nc(NCCNC(=O)c2cccc(F)c2)n1 |
| InChI | InChI=1S/C18H22FN5O/c1-13-11-16(24-9-2-3-10-24)23-18(22-13)21-8-7-20-17(25)14-5-4-6-15(19)12-14/h4-6,11-12H,2-3,7-10H2,1H3,(H,20,25)(H,21,22,23) |
| InChIKey | FCVKLNOCKIVLAM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|